C20H24F12O4 — CID 87761830
[3,5-bis[3,4,4-trifluoro-2-hydroxy-2-(trifluoromethyl)butyl]cyclohexyl] 2-methylprop-2-enoate (PubChem CID 87761830) has the molecular formula C20H24F12O4 and a molecular weight of 556.38 g/mol. Its IUPAC name is [3,5-bis[3,4,4-trifluoro-2-hydroxy-2-(trifluoromethyl)butyl]cyclohexyl] 2-methylprop-2-enoate.
| Compound Name | [3,5-bis[3,4,4-trifluoro-2-hydroxy-2-(trifluoromethyl)butyl]cyclohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87761830 |
| Molecular Formula | C20H24F12O4 |
| Molecular Weight | 556.38 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | [3,5-bis[3,4,4-trifluoro-2-hydroxy-2-(trifluoromethyl)butyl]cyclohexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC(CC(O)(C(F)C(F)F)C(F)(F)F)CC(CC(O)(C(F)C(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C20H24F12O4/c1-8(2)16(33)36-11-4-9(6-17(34,19(27,28)29)12(21)14(23)24)3-10(5-11)7-18(35,20(30,31)32)13(22)15(25)26/h9-15,34-35H,1,3-7H2,2H3 |
| InChIKey | KIIKFSJOWDGHLK-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.38 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|