C16H22F6O4 — CID 129118646
[4-ethyl-4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]cyclohexyl] 2-methylprop-2-enoate (PubChem CID 129118646) has the molecular formula C16H22F6O4 and a molecular weight of 392.34 g/mol. Its IUPAC name is [4-ethyl-4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]cyclohexyl] 2-methylprop-2-enoate.
| Compound Name | [4-ethyl-4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]cyclohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129118646 |
| Molecular Formula | C16H22F6O4 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | [4-ethyl-4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]cyclohexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCC(CC)(OCC(O)(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H22F6O4/c1-4-13(7-5-11(6-8-13)26-12(23)10(2)3)25-9-14(24,15(17,18)19)16(20,21)22/h11,24H,2,4-9H2,1,3H3 |
| InChIKey | XFTCAXDFKHULFB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|