C18H29F3O4 — CID 129118748
[4-methyl-4-(4,4,4-trifluoro-3-hydroxy-2,3-dimethylbutan-2-yl)oxycycloheptyl] 2-methylprop-2-enoate (PubChem CID 129118748) has the molecular formula C18H29F3O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is [4-methyl-4-(4,4,4-trifluoro-3-hydroxy-2,3-dimethylbutan-2-yl)oxycycloheptyl] 2-methylprop-2-enoate.
| Compound Name | [4-methyl-4-(4,4,4-trifluoro-3-hydroxy-2,3-dimethylbutan-2-yl)oxycycloheptyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129118748 |
| Molecular Formula | C18H29F3O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | [4-methyl-4-(4,4,4-trifluoro-3-hydroxy-2,3-dimethylbutan-2-yl)oxycycloheptyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCCC(C)(OC(C)(C)C(C)(O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H29F3O4/c1-12(2)14(22)24-13-8-7-10-16(5,11-9-13)25-15(3,4)17(6,23)18(19,20)21/h13,23H,1,7-11H2,2-6H3 |
| InChIKey | NXDSGUJUARQCAI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|