C20H27F9O6 — CID 58388556
[3-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-5-[2-(methoxymethoxy)propan-2-yl]cyclohexyl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 58388556) has the molecular formula C20H27F9O6 and a molecular weight of 534.41 g/mol. Its IUPAC name is [3-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-5-[2-(methoxymethoxy)propan-2-yl]cyclohexyl] 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | [3-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-5-[2-(methoxymethoxy)propan-2-yl]cyclohexyl] 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 58388556 |
| Molecular Formula | C20H27F9O6 |
| Molecular Weight | 534.41 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | [3-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-5-[2-(methoxymethoxy)propan-2-yl]cyclohexyl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC1CC(C(C)(C)OCOC)CC(C(OCOC)(C(F)(F)F)C(F)(F)F)C1)C(F)(F)F |
| InChI | InChI=1S/C20H27F9O6/c1-11(18(21,22)23)15(30)35-14-7-12(16(2,3)33-9-31-4)6-13(8-14)17(19(24,25)26,20(27,28)29)34-10-32-5/h12-14H,1,6-10H2,2-5H3 |
| InChIKey | QEJGYDLACKAFBT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.41 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|