About 3-(2,4-dimethylcyclobutyl)-1,2-dimethyl-1-pentan-2-ylcyclopentane
3-(2,4-dimethylcyclobutyl)-1,2-dimethyl-1-pentan-2-ylcyclopentane (PubChem CID 123248960) has the molecular formula C18H34
and a molecular weight of 250.47 g/mol. Its IUPAC name is 3-(2,4-dimethylcyclobutyl)-1,2-dimethyl-1-pentan-2-ylcyclopentane.
Molecular Properties
| Compound Name | 3-(2,4-dimethylcyclobutyl)-1,2-dimethyl-1-pentan-2-ylcyclopentane |
| PubChem CID | 123248960 |
| Molecular Formula | C18H34 |
| Molecular Weight | 250.47 g/mol |
| Exact Mass | 250.27 |
| IUPAC Name | 3-(2,4-dimethylcyclobutyl)-1,2-dimethyl-1-pentan-2-ylcyclopentane |
| SMILES | CCCC(C)C1(C)CCC(C2C(C)CC2C)C1C |
| InChI | InChI=1S/C18H34/c1-7-8-14(4)18(6)10-9-16(15(18)5)17-12(2)11-13(17)3/h12-17H,7-11H2,1-6H3 |
| InChIKey | LJKWJQNPUIZQTK-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.47 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-(2,4-dimethylcyclobutyl)-1,2-dimethyl-1-pentan-2-ylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-dimethylcyclobutyl)-1,2-dimethyl-1-pentan-2-ylcyclopentane?
The IUPAC name of 3-(2,4-dimethylcyclobutyl)-1,2-dimethyl-1-pentan-2-ylcyclopentane (CID 123248960) is 3-(2,4-dimethylcyclobutyl)-1,2-dimethyl-1-pentan-2-ylcyclopentane.
What is the SMILES notation for 3-(2,4-dimethylcyclobutyl)-1,2-dimethyl-1-pentan-2-ylcyclopentane?
The canonical SMILES for 3-(2,4-dimethylcyclobutyl)-1,2-dimethyl-1-pentan-2-ylcyclopentane is CCCC(C)C1(C)CCC(C2C(C)CC2C)C1C.
What is the InChIKey of 3-(2,4-dimethylcyclobutyl)-1,2-dimethyl-1-pentan-2-ylcyclopentane?
The InChIKey is LJKWJQNPUIZQTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34/c1-7-8-14(4)18(6)10-9-16(15(18)5)17-12(2)11-13(17)3/h12-17H,7-11H2,1-6H3.
What are the key properties of 3-(2,4-dimethylcyclobutyl)-1,2-dimethyl-1-pentan-2-ylcyclopentane?
3-(2,4-dimethylcyclobutyl)-1,2-dimethyl-1-pentan-2-ylcyclopentane has a molecular weight of 250.47 g/mol, XLogP of 5.77, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dimethylcyclobutyl)-1,2-dimethyl-1-pentan-2-ylcyclopentane is sourced from PubChem (CID 123248960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).