C16H28O2 — CID 57019683
3a,6,6,9a-tetramethyl-1,2,4,5,5a,7,8,9-octahydrobenzo[e][1]benzofuran-9b-ol (PubChem CID 57019683) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 3a,6,6,9a-tetramethyl-1,2,4,5,5a,7,8,9-octahydrobenzo[e][1]benzofuran-9b-ol.
| Compound Name | 3a,6,6,9a-tetramethyl-1,2,4,5,5a,7,8,9-octahydrobenzo[e][1]benzofuran-9b-ol |
|---|---|
| PubChem CID | 57019683 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 3a,6,6,9a-tetramethyl-1,2,4,5,5a,7,8,9-octahydrobenzo[e][1]benzofuran-9b-ol |
| SMILES | CC1(C)CCCC2(C)C1CCC1(C)OCCC12O |
| InChI | InChI=1S/C16H28O2/c1-13(2)7-5-8-14(3)12(13)6-9-15(4)16(14,17)10-11-18-15/h12,17H,5-11H2,1-4H3 |
| InChIKey | BERKMPSJMDPVEW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |