C18H30O — CID 539256
2,6,6,10,11-pentamethyl-14-oxatetracyclo[9.2.1.01,10.02,7]tetradecane (PubChem CID 539256) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is 2,6,6,10,11-pentamethyl-14-oxatetracyclo[9.2.1.01,10.02,7]tetradecane.
| Compound Name | 2,6,6,10,11-pentamethyl-14-oxatetracyclo[9.2.1.01,10.02,7]tetradecane |
|---|---|
| PubChem CID | 539256 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 2,6,6,10,11-pentamethyl-14-oxatetracyclo[9.2.1.01,10.02,7]tetradecane |
| SMILES | CC1(C)CCCC2(C)C1CCC1(C)C3(C)CCC21O3 |
| InChI | InChI=1S/C18H30O/c1-14(2)8-6-9-15(3)13(14)7-10-16(4)17(5)11-12-18(15,16)19-17/h13H,6-12H2,1-5H3 |
| InChIKey | DBZUOZHCPCRRLC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |