C16H24O2 — CID 10106081
(1R,3aS,7aR)-1-(furan-3-yl)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydroinden-1-ol (PubChem CID 10106081) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (1R,3aS,7aR)-1-(furan-3-yl)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydroinden-1-ol.
| Compound Name | (1R,3aS,7aR)-1-(furan-3-yl)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydroinden-1-ol |
|---|---|
| PubChem CID | 10106081 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (1R,3aS,7aR)-1-(furan-3-yl)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydroinden-1-ol |
| SMILES | CC1(C)CCC[C@]2(C)[C@H]1CC[C@]2(O)c1ccoc1 |
| InChI | InChI=1S/C16H24O2/c1-14(2)7-4-8-15(3)13(14)5-9-16(15,17)12-6-10-18-11-12/h6,10-11,13,17H,4-5,7-9H2,1-3H3/t13-,15+,16-/m0/s1 |
| InChIKey | PSVMCCIAGQGZBX-IMJJTQAJSA-N |
| XLogP | 4.09 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |