C15H20O2 — CID 10421461
(1S,2R,4R)-2-(furan-3-yl)-5,8,8-trimethylbicyclo[2.2.2]oct-5-en-2-ol (PubChem CID 10421461) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (1S,2R,4R)-2-(furan-3-yl)-5,8,8-trimethylbicyclo[2.2.2]oct-5-en-2-ol.
| Compound Name | (1S,2R,4R)-2-(furan-3-yl)-5,8,8-trimethylbicyclo[2.2.2]oct-5-en-2-ol |
|---|---|
| PubChem CID | 10421461 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (1S,2R,4R)-2-(furan-3-yl)-5,8,8-trimethylbicyclo[2.2.2]oct-5-en-2-ol |
| SMILES | CC1=C[C@@H]2CC(C)(C)[C@H]1C[C@]2(O)c1ccoc1 |
| InChI | InChI=1S/C15H20O2/c1-10-6-12-7-14(2,3)13(10)8-15(12,16)11-4-5-17-9-11/h4-6,9,12-13,16H,7-8H2,1-3H3/t12-,13+,15+/m1/s1 |
| InChIKey | PHMBZANOEGZOGY-IPYPFGDCSA-N |
| XLogP | 3.48 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|