C14H18O5 — CID 102069340
ethyl (1R,2S,4S)-2-(furan-3-yl)-2,4-dihydroxy-5-methylidenecyclohexane-1-carboxylate (PubChem CID 102069340) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is ethyl (1R,2S,4S)-2-(furan-3-yl)-2,4-dihydroxy-5-methylidenecyclohexane-1-carboxylate.
| Compound Name | ethyl (1R,2S,4S)-2-(furan-3-yl)-2,4-dihydroxy-5-methylidenecyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 102069340 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | ethyl (1R,2S,4S)-2-(furan-3-yl)-2,4-dihydroxy-5-methylidenecyclohexane-1-carboxylate |
| SMILES | C=C1C[C@@H](C(=O)OCC)[C@](O)(c2ccoc2)C[C@@H]1O |
| InChI | InChI=1S/C14H18O5/c1-3-19-13(16)11-6-9(2)12(15)7-14(11,17)10-4-5-18-8-10/h4-5,8,11-12,15,17H,2-3,6-7H2,1H3/t11-,12-,14+/m0/s1 |
| InChIKey | XCVOFYDKROWMJI-SGMGOOAPSA-N |
| XLogP | 1.36 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|