C15H20O3 — CID 91753128
1-[(1S,2R,5R)-2-(furan-3-yl)-2-hydroxy-5-methylcyclopentyl]-3-methylbut-2-en-1-one (PubChem CID 91753128) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 1-[(1S,2R,5R)-2-(furan-3-yl)-2-hydroxy-5-methylcyclopentyl]-3-methylbut-2-en-1-one.
| Compound Name | 1-[(1S,2R,5R)-2-(furan-3-yl)-2-hydroxy-5-methylcyclopentyl]-3-methylbut-2-en-1-one |
|---|---|
| PubChem CID | 91753128 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 1-[(1S,2R,5R)-2-(furan-3-yl)-2-hydroxy-5-methylcyclopentyl]-3-methylbut-2-en-1-one |
| SMILES | CC(C)=CC(=O)[C@H]1[C@H](C)CC[C@]1(O)c1ccoc1 |
| InChI | InChI=1S/C15H20O3/c1-10(2)8-13(16)14-11(3)4-6-15(14,17)12-5-7-18-9-12/h5,7-9,11,14,17H,4,6H2,1-3H3/t11-,14-,15+/m1/s1 |
| InChIKey | MZISRFGDZVZINJ-DFBGVHRSSA-N |
| XLogP | 3.05 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|