C23H32O3 — CID 57312240
(8R,9R,10R,13S,14S)-17-(furan-3-yl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 57312240) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-17-(furan-3-yl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9R,10R,13S,14S)-17-(furan-3-yl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 57312240 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (8R,9R,10R,13S,14S)-17-(furan-3-yl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CCC(O)CC1=CC[C@@H]1[C@H]2CC[C@@]2(C)[C@H]1CCC2(O)c1ccoc1 |
| InChI | InChI=1S/C23H32O3/c1-21-9-5-17(24)13-15(21)3-4-18-19(21)6-10-22(2)20(18)7-11-23(22,25)16-8-12-26-14-16/h3,8,12,14,17-20,24-25H,4-7,9-11,13H2,1-2H3/t17?,18-,19-,20+,21+,22+,23?/m1/s1 |
| InChIKey | RORRUUFLEVZPCC-LBDSVRDYSA-N |
| XLogP | 4.79 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|