C31H47NO3S — CID 67748361
(3S,8R,9S,10R,13S,14S,17S)-17-(furan-3-yl)-10,13-dimethyl-3-[2-(2-pyrrolidin-1-ylethoxy)ethylsulfanyl]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 67748361) has the molecular formula C31H47NO3S and a molecular weight of 513.79 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S,17S)-17-(furan-3-yl)-10,13-dimethyl-3-[2-(2-pyrrolidin-1-ylethoxy)ethylsulfanyl]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (3S,8R,9S,10R,13S,14S,17S)-17-(furan-3-yl)-10,13-dimethyl-3-[2-(2-pyrrolidin-1-ylethoxy)ethylsulfanyl]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 67748361 |
| Molecular Formula | C31H47NO3S |
| Molecular Weight | 513.79 g/mol |
| Exact Mass | 513.33 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S,17S)-17-(furan-3-yl)-10,13-dimethyl-3-[2-(2-pyrrolidin-1-ylethoxy)ethylsulfanyl]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@]12CC[C@H](SCCOCCN3CCCC3)CC1=CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(O)c1ccoc1 |
| InChI | InChI=1S/C31H47NO3S/c1-29-11-7-25(36-20-19-34-18-16-32-14-3-4-15-32)21-23(29)5-6-26-27(29)8-12-30(2)28(26)9-13-31(30,33)24-10-17-35-22-24/h5,10,17,22,25-28,33H,3-4,6-9,11-16,18-21H2,1-2H3/t25-,26+,27-,28-,29-,30-,31+/m0/s1 |
| InChIKey | XSQSREGXMREBIH-IXBKPJASSA-N |
| XLogP | 6.64 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.79 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|