C31H45NO4 — CID 57312472
1-[2-[2-[[(3R,4R,7R,11S,12R)-8-(furan-3-yl)-3,7-dimethyl-18-oxapentacyclo[8.7.1.03,15.04,12.07,11]octadec-14-en-17-yl]oxy]ethoxy]ethyl]pyrrolidine (PubChem CID 57312472) has the molecular formula C31H45NO4 and a molecular weight of 495.70 g/mol. Its IUPAC name is 1-[2-[2-[[(3R,4R,7R,11S,12R)-8-(furan-3-yl)-3,7-dimethyl-18-oxapentacyclo[8.7.1.03,15.04,12.07,11]octadec-14-en-17-yl]oxy]ethoxy]ethyl]pyrrolidine.
| Compound Name | 1-[2-[2-[[(3R,4R,7R,11S,12R)-8-(furan-3-yl)-3,7-dimethyl-18-oxapentacyclo[8.7.1.03,15.04,12.07,11]octadec-14-en-17-yl]oxy]ethoxy]ethyl]pyrrolidine |
|---|---|
| PubChem CID | 57312472 |
| Molecular Formula | C31H45NO4 |
| Molecular Weight | 495.70 g/mol |
| Exact Mass | 495.33 |
| IUPAC Name | 1-[2-[2-[[(3R,4R,7R,11S,12R)-8-(furan-3-yl)-3,7-dimethyl-18-oxapentacyclo[8.7.1.03,15.04,12.07,11]octadec-14-en-17-yl]oxy]ethoxy]ethyl]pyrrolidine |
| SMILES | C[C@@]12CC3OC4CC(c5ccoc5)[C@@]5(C)CC[C@@H]1[C@@H](CC=C2CC3OCCOCCN1CCCC1)[C@H]45 |
| InChI | InChI=1S/C31H45NO4/c1-30-9-7-24-23-6-5-22-17-26(35-16-15-33-14-12-32-10-3-4-11-32)28(19-31(22,24)2)36-27(29(23)30)18-25(30)21-8-13-34-20-21/h5,8,13,20,23-29H,3-4,6-7,9-12,14-19H2,1-2H3/t23-,24-,25?,26?,27?,28?,29-,30-,31+/m1/s1 |
| InChIKey | NDYXIJQTWXNRMR-KQGBPPDHSA-N |
| XLogP | 5.81 |
| TPSA | 44.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.70 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|