C29H43NO2 — CID 154481595
1-[1-[[(8S,9S,10R,13S,14S,17R)-17-(furan-3-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-2-yl]oxy]ethyl]pyrrolidine (PubChem CID 154481595) has the molecular formula C29H43NO2 and a molecular weight of 437.67 g/mol. Its IUPAC name is 1-[1-[[(8S,9S,10R,13S,14S,17R)-17-(furan-3-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-2-yl]oxy]ethyl]pyrrolidine.
| Compound Name | 1-[1-[[(8S,9S,10R,13S,14S,17R)-17-(furan-3-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-2-yl]oxy]ethyl]pyrrolidine |
|---|---|
| PubChem CID | 154481595 |
| Molecular Formula | C29H43NO2 |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 437.33 |
| IUPAC Name | 1-[1-[[(8S,9S,10R,13S,14S,17R)-17-(furan-3-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-2-yl]oxy]ethyl]pyrrolidine |
| SMILES | CC(OC1CCC2=CC[C@H]3[C@@H]4CC[C@@H](c5ccoc5)[C@@]4(C)CC[C@@H]3[C@@]2(C)C1)N1CCCC1 |
| InChI | InChI=1S/C29H43NO2/c1-20(30-15-4-5-16-30)32-23-8-6-22-7-9-24-26-11-10-25(21-13-17-31-19-21)28(26,2)14-12-27(24)29(22,3)18-23/h7,13,17,19-20,23-27H,4-6,8-12,14-16,18H2,1-3H3/t20?,23?,24-,25-,26-,27-,28+,29-/m0/s1 |
| InChIKey | KLNMZSPDENDUPB-JBDKAKDFSA-N |
| XLogP | 7.15 |
| TPSA | 25.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|