C26H41NO2 — CID 66706094
2-[[(3S,5R,8R,9S,10S,13S,14R,17S)-17-(furan-3-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-N-methylethanamine (PubChem CID 66706094) has the molecular formula C26H41NO2 and a molecular weight of 399.62 g/mol. Its IUPAC name is 2-[[(3S,5R,8R,9S,10S,13S,14R,17S)-17-(furan-3-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-N-methylethanamine.
| Compound Name | 2-[[(3S,5R,8R,9S,10S,13S,14R,17S)-17-(furan-3-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-N-methylethanamine |
|---|---|
| PubChem CID | 66706094 |
| Molecular Formula | C26H41NO2 |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.31 |
| IUPAC Name | 2-[[(3S,5R,8R,9S,10S,13S,14R,17S)-17-(furan-3-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-N-methylethanamine |
| SMILES | CNCCO[C@H]1CC[C@@]2(C)[C@H](CC[C@H]3[C@H]4CC[C@H](c5ccoc5)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C26H41NO2/c1-25-11-8-20(29-15-13-27-3)16-19(25)4-5-21-23-7-6-22(18-10-14-28-17-18)26(23,2)12-9-24(21)25/h10,14,17,19-24,27H,4-9,11-13,15-16H2,1-3H3/t19-,20+,21+,22-,23-,24+,25+,26-/m1/s1 |
| InChIKey | OSJCWBQKAWRXFV-BHHKCJQWSA-N |
| XLogP | 6.01 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|