C26H41NO3 — CID 70043520
(8R,9R,10S,13R,14R)-17-(furan-3-yl)-10,13-dimethyl-3-[2-(methylamino)ethoxy]-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-ol (PubChem CID 70043520) has the molecular formula C26H41NO3 and a molecular weight of 415.62 g/mol. Its IUPAC name is (8R,9R,10S,13R,14R)-17-(furan-3-yl)-10,13-dimethyl-3-[2-(methylamino)ethoxy]-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-ol.
| Compound Name | (8R,9R,10S,13R,14R)-17-(furan-3-yl)-10,13-dimethyl-3-[2-(methylamino)ethoxy]-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-ol |
|---|---|
| PubChem CID | 70043520 |
| Molecular Formula | C26H41NO3 |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.31 |
| IUPAC Name | (8R,9R,10S,13R,14R)-17-(furan-3-yl)-10,13-dimethyl-3-[2-(methylamino)ethoxy]-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-ol |
| SMILES | CNCCOC1CC[C@@]2(C)C(CC[C@@H]3[C@H]2CC[C@]2(C)C(c4ccoc4)CC[C@@]32O)C1 |
| InChI | InChI=1S/C26H41NO3/c1-24-10-6-20(30-15-13-27-3)16-19(24)4-5-23-22(24)7-11-25(2)21(8-12-26(23,25)28)18-9-14-29-17-18/h9,14,17,19-23,27-28H,4-8,10-13,15-16H2,1-3H3/t19?,20?,21?,22-,23-,24+,25-,26-/m1/s1 |
| InChIKey | DMFDJNPRYSCGPN-OYTBPDQESA-N |
| XLogP | 5.13 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|