C23H34O2 — CID 70044368
(8R,9R,10S,13R,14R)-17-(furan-3-yl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-ol (PubChem CID 70044368) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is (8R,9R,10S,13R,14R)-17-(furan-3-yl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-ol.
| Compound Name | (8R,9R,10S,13R,14R)-17-(furan-3-yl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-ol |
|---|---|
| PubChem CID | 70044368 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | (8R,9R,10S,13R,14R)-17-(furan-3-yl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-ol |
| SMILES | C[C@]12CCCCC1CC[C@@H]1[C@H]2CC[C@]2(C)C(c3ccoc3)CC[C@@]12O |
| InChI | InChI=1S/C23H34O2/c1-21-11-4-3-5-17(21)6-7-20-19(21)8-12-22(2)18(9-13-23(20,22)24)16-10-14-25-15-16/h10,14-15,17-20,24H,3-9,11-13H2,1-2H3/t17?,18?,19-,20-,21+,22-,23-/m1/s1 |
| InChIKey | XLZKYLHOPBGXNM-YISAACIPSA-N |
| XLogP | 5.91 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |