C26H38O3 — CID 70046049
(8R,9R,10S,13R,14R)-17-(furan-3-yl)-10,13-dimethyl-3-prop-2-enoxy-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-ol (PubChem CID 70046049) has the molecular formula C26H38O3 and a molecular weight of 398.59 g/mol. Its IUPAC name is (8R,9R,10S,13R,14R)-17-(furan-3-yl)-10,13-dimethyl-3-prop-2-enoxy-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-ol.
| Compound Name | (8R,9R,10S,13R,14R)-17-(furan-3-yl)-10,13-dimethyl-3-prop-2-enoxy-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-ol |
|---|---|
| PubChem CID | 70046049 |
| Molecular Formula | C26H38O3 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | (8R,9R,10S,13R,14R)-17-(furan-3-yl)-10,13-dimethyl-3-prop-2-enoxy-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-ol |
| SMILES | C=CCOC1CC[C@@]2(C)C(CC[C@@H]3[C@H]2CC[C@]2(C)C(c4ccoc4)CC[C@@]32O)C1 |
| InChI | InChI=1S/C26H38O3/c1-4-14-29-20-7-11-24(2)19(16-20)5-6-23-22(24)8-12-25(3)21(9-13-26(23,25)27)18-10-15-28-17-18/h4,10,15,17,19-23,27H,1,5-9,11-14,16H2,2-3H3/t19?,20?,21?,22-,23-,24+,25-,26-/m1/s1 |
| InChIKey | HGZWZGYDOCDTGP-OYTBPDQESA-N |
| XLogP | 6.09 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|