C30H48NO3+ — CID 70076772
(8R,9R,10S,13R,14R)-17-(furan-3-yl)-10,13-dimethyl-3-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-ol (PubChem CID 70076772) has the molecular formula C30H48NO3+ and a molecular weight of 470.72 g/mol. Its IUPAC name is (8R,9R,10S,13R,14R)-17-(furan-3-yl)-10,13-dimethyl-3-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-ol.
| Compound Name | (8R,9R,10S,13R,14R)-17-(furan-3-yl)-10,13-dimethyl-3-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-ol |
|---|---|
| PubChem CID | 70076772 |
| Molecular Formula | C30H48NO3+ |
| Molecular Weight | 470.72 g/mol |
| Exact Mass | 470.36 |
| IUPAC Name | (8R,9R,10S,13R,14R)-17-(furan-3-yl)-10,13-dimethyl-3-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-ol |
| SMILES | C[C@]12CCC(OCC[N+]3(C)CCCC3)CC1CC[C@@H]1[C@H]2CC[C@]2(C)C(c3ccoc3)CC[C@@]12O |
| InChI | InChI=1S/C30H48NO3/c1-28-12-8-24(34-19-17-31(3)15-4-5-16-31)20-23(28)6-7-27-26(28)9-13-29(2)25(10-14-30(27,29)32)22-11-18-33-21-22/h11,18,21,23-27,32H,4-10,12-17,19-20H2,1-3H3/q+1/t23?,24?,25?,26-,27-,28+,29-,30-/m1/s1 |
| InChIKey | YZIHVHWLCQRVIV-WFWUEMHVSA-N |
| XLogP | 6.15 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.72 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|