C30H47INO3+ — CID 70047260
(8R,9R,10R,13R,14R)-17-(furan-3-yl)-5-iodo-10,13-dimethyl-3-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-14-ol (PubChem CID 70047260) has the molecular formula C30H47INO3+ and a molecular weight of 596.61 g/mol. Its IUPAC name is (8R,9R,10R,13R,14R)-17-(furan-3-yl)-5-iodo-10,13-dimethyl-3-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-14-ol.
| Compound Name | (8R,9R,10R,13R,14R)-17-(furan-3-yl)-5-iodo-10,13-dimethyl-3-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-14-ol |
|---|---|
| PubChem CID | 70047260 |
| Molecular Formula | C30H47INO3+ |
| Molecular Weight | 596.61 g/mol |
| Exact Mass | 596.26 |
| IUPAC Name | (8R,9R,10R,13R,14R)-17-(furan-3-yl)-5-iodo-10,13-dimethyl-3-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-14-ol |
| SMILES | C[C@]12CCC(OCC[N+]3(C)CCCC3)CC1(I)CC[C@@H]1[C@H]2CC[C@]2(C)C(c3ccoc3)CC[C@@]12O |
| InChI | InChI=1S/C30H47INO3/c1-27-11-6-23(35-19-17-32(3)15-4-5-16-32)20-29(27,31)13-8-26-25(27)7-12-28(2)24(9-14-30(26,28)33)22-10-18-34-21-22/h10,18,21,23-26,33H,4-9,11-17,19-20H2,1-3H3/q+1/t23?,24?,25-,26-,27-,28-,29?,30-/m1/s1 |
| InChIKey | ALHNDEMSBRNFDH-CFXNQOTNSA-N |
| XLogP | 6.70 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.61 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|