C26H39NO2 — CID 70045680
3-[[(3S,8S,9S,10R,13S,14S,17S)-17-(furan-3-yl)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]propan-1-amine (PubChem CID 70045680) has the molecular formula C26H39NO2 and a molecular weight of 397.60 g/mol. Its IUPAC name is 3-[[(3S,8S,9S,10R,13S,14S,17S)-17-(furan-3-yl)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]propan-1-amine.
| Compound Name | 3-[[(3S,8S,9S,10R,13S,14S,17S)-17-(furan-3-yl)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]propan-1-amine |
|---|---|
| PubChem CID | 70045680 |
| Molecular Formula | C26H39NO2 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.30 |
| IUPAC Name | 3-[[(3S,8S,9S,10R,13S,14S,17S)-17-(furan-3-yl)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]propan-1-amine |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=C[C@@H](OCCCN)CC[C@@]43C)[C@@H]1CC[C@@H]2c1ccoc1 |
| InChI | InChI=1S/C26H39NO2/c1-25-11-8-20(29-14-3-13-27)16-19(25)4-5-21-23-7-6-22(18-10-15-28-17-18)26(23,2)12-9-24(21)25/h10,15-17,20-24H,3-9,11-14,27H2,1-2H3/t20-,21-,22+,23-,24-,25-,26+/m0/s1 |
| InChIKey | DVEKSTCCXYXGHV-JRRPMJJTSA-N |
| XLogP | 6.06 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|