C31H50O4Si — CID 67739063
(3S,8R,9S,10R,13S,14S,17S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-17-(furan-3-yl)-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 67739063) has the molecular formula C31H50O4Si and a molecular weight of 514.82 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S,17S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-17-(furan-3-yl)-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (3S,8R,9S,10R,13S,14S,17S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-17-(furan-3-yl)-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 67739063 |
| Molecular Formula | C31H50O4Si |
| Molecular Weight | 514.82 g/mol |
| Exact Mass | 514.35 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S,17S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-17-(furan-3-yl)-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCCO[C@@H]1C=C2CC[C@@H]3[C@H](CC[C@@]4(C)[C@H]3CC[C@@]4(O)c3ccoc3)[C@@]2(C)CC1 |
| InChI | InChI=1S/C31H50O4Si/c1-28(2,3)36(6,7)35-19-18-34-24-10-14-29(4)22(20-24)8-9-25-26(29)11-15-30(5)27(25)12-16-31(30,32)23-13-17-33-21-23/h13,17,20-21,24-27,32H,8-12,14-16,18-19H2,1-7H3/t24-,25+,26-,27-,29-,30-,31+/m0/s1 |
| InChIKey | DKNJNOGXCMJXAQ-IEABMDAWSA-N |
| XLogP | 7.84 |
| TPSA | 51.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.82 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|