C35H54N2O4 — CID 67639896
(3S,8R,9S,10R,13S,14S,17R)-17-(furan-3-yl)-10,13-dimethyl-3,17-bis(2-pyrrolidin-1-ylethoxy)-2,3,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-14-ol (PubChem CID 67639896) has the molecular formula C35H54N2O4 and a molecular weight of 566.83 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S,17R)-17-(furan-3-yl)-10,13-dimethyl-3,17-bis(2-pyrrolidin-1-ylethoxy)-2,3,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-14-ol.
| Compound Name | (3S,8R,9S,10R,13S,14S,17R)-17-(furan-3-yl)-10,13-dimethyl-3,17-bis(2-pyrrolidin-1-ylethoxy)-2,3,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-14-ol |
|---|---|
| PubChem CID | 67639896 |
| Molecular Formula | C35H54N2O4 |
| Molecular Weight | 566.83 g/mol |
| Exact Mass | 566.41 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S,17R)-17-(furan-3-yl)-10,13-dimethyl-3,17-bis(2-pyrrolidin-1-ylethoxy)-2,3,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-14-ol |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=C[C@@H](OCCN5CCCC5)CC[C@@]43C)[C@@]1(O)CC[C@@]2(OCCN1CCCC1)c1ccoc1 |
| InChI | InChI=1S/C35H54N2O4/c1-32-12-9-29(40-23-20-36-16-3-4-17-36)25-27(32)7-8-31-30(32)10-13-33(2)34(31,38)14-15-35(33,28-11-22-39-26-28)41-24-21-37-18-5-6-19-37/h11,22,25-26,29-31,38H,3-10,12-21,23-24H2,1-2H3/t29-,30-,31+,32-,33-,34-,35+/m0/s1 |
| InChIKey | DUTZOOCPZUOXDY-CVZSTDQWSA-N |
| XLogP | 6.15 |
| TPSA | 58.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.83 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|