C38H60N2O3 — CID 67680462
(8R,9R,10S,13S,14R)-10,13-dimethyl-17-(4-methylphenyl)-3,17-bis(2-pyrrolidin-1-ylethoxy)-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-14-ol (PubChem CID 67680462) has the molecular formula C38H60N2O3 and a molecular weight of 592.91 g/mol. Its IUPAC name is (8R,9R,10S,13S,14R)-10,13-dimethyl-17-(4-methylphenyl)-3,17-bis(2-pyrrolidin-1-ylethoxy)-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-14-ol.
| Compound Name | (8R,9R,10S,13S,14R)-10,13-dimethyl-17-(4-methylphenyl)-3,17-bis(2-pyrrolidin-1-ylethoxy)-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-14-ol |
|---|---|
| PubChem CID | 67680462 |
| Molecular Formula | C38H60N2O3 |
| Molecular Weight | 592.91 g/mol |
| Exact Mass | 592.46 |
| IUPAC Name | (8R,9R,10S,13S,14R)-10,13-dimethyl-17-(4-methylphenyl)-3,17-bis(2-pyrrolidin-1-ylethoxy)-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-14-ol |
| SMILES | Cc1ccc(C2(OCCN3CCCC3)CC[C@@]3(O)[C@@H]4CCC5CC(OCCN6CCCC6)CC[C@]5(C)[C@@H]4CC[C@]23C)cc1 |
| InChI | InChI=1S/C38H60N2O3/c1-29-8-10-30(11-9-29)38(43-27-25-40-22-6-7-23-40)19-18-37(41)34-13-12-31-28-32(42-26-24-39-20-4-5-21-39)14-16-35(31,2)33(34)15-17-36(37,38)3/h8-11,31-34,41H,4-7,12-28H2,1-3H3/t31?,32?,33-,34-,35+,36+,37-,38?/m1/s1 |
| InChIKey | AVDDOJOTIMECGG-XJFXOKSKSA-N |
| XLogP | 6.94 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.91 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |