C29H49NO4 — CID 70043958
(8R,9R,10S,13R,14R)-17-(1,3-dioxolan-2-yl)-10,13-dimethyl-3-(3-pyrrolidin-1-ylpropoxy)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-ol (PubChem CID 70043958) has the molecular formula C29H49NO4 and a molecular weight of 475.71 g/mol. Its IUPAC name is (8R,9R,10S,13R,14R)-17-(1,3-dioxolan-2-yl)-10,13-dimethyl-3-(3-pyrrolidin-1-ylpropoxy)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-ol.
| Compound Name | (8R,9R,10S,13R,14R)-17-(1,3-dioxolan-2-yl)-10,13-dimethyl-3-(3-pyrrolidin-1-ylpropoxy)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-ol |
|---|---|
| PubChem CID | 70043958 |
| Molecular Formula | C29H49NO4 |
| Molecular Weight | 475.71 g/mol |
| Exact Mass | 475.37 |
| IUPAC Name | (8R,9R,10S,13R,14R)-17-(1,3-dioxolan-2-yl)-10,13-dimethyl-3-(3-pyrrolidin-1-ylpropoxy)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-ol |
| SMILES | C[C@]12CCC(OCCCN3CCCC3)CC1CC[C@@H]1[C@H]2CC[C@]2(C)C(C3OCCO3)CC[C@@]12O |
| InChI | InChI=1S/C29H49NO4/c1-27-11-8-22(32-17-5-16-30-14-3-4-15-30)20-21(27)6-7-24-23(27)9-12-28(2)25(10-13-29(24,28)31)26-33-18-19-34-26/h21-26,31H,3-20H2,1-2H3/t21?,22?,23-,24-,25?,27+,28-,29-/m1/s1 |
| InChIKey | WBQAWUNWMHMBSX-APTFCIEESA-N |
| XLogP | 5.00 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.71 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|