C27H47NO4 — CID 21309613
(3S,5S,6S,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-[2-(2-pyrrolidin-1-ylethoxy)ethoxy]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-6,17-diol (PubChem CID 21309613) has the molecular formula C27H47NO4 and a molecular weight of 449.68 g/mol. Its IUPAC name is (3S,5S,6S,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-[2-(2-pyrrolidin-1-ylethoxy)ethoxy]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-6,17-diol.
| Compound Name | (3S,5S,6S,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-[2-(2-pyrrolidin-1-ylethoxy)ethoxy]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-6,17-diol |
|---|---|
| PubChem CID | 21309613 |
| Molecular Formula | C27H47NO4 |
| Molecular Weight | 449.68 g/mol |
| Exact Mass | 449.35 |
| IUPAC Name | (3S,5S,6S,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-[2-(2-pyrrolidin-1-ylethoxy)ethoxy]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-6,17-diol |
| SMILES | C[C@]12CC[C@H](OCCOCCN3CCCC3)C[C@@H]1[C@@H](O)C[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C27H47NO4/c1-26-9-7-19(32-16-15-31-14-13-28-11-3-4-12-28)17-23(26)24(29)18-20-21-5-6-25(30)27(21,2)10-8-22(20)26/h19-25,29-30H,3-18H2,1-2H3/t19-,20-,21-,22-,23+,24-,25-,26+,27-/m0/s1 |
| InChIKey | ZJHFIUOKWRUPLH-DUWVVQMUSA-N |
| XLogP | 3.86 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.68 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|