C27H43NO4 — CID 70346488
(5S,8R,9S,10R,13S,14S)-10,13-dimethyl-2-[2-(2-pyrrolidin-1-ylethoxy)ethoxy]-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-6,17-dione (PubChem CID 70346488) has the molecular formula C27H43NO4 and a molecular weight of 445.64 g/mol. Its IUPAC name is (5S,8R,9S,10R,13S,14S)-10,13-dimethyl-2-[2-(2-pyrrolidin-1-ylethoxy)ethoxy]-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-6,17-dione.
| Compound Name | (5S,8R,9S,10R,13S,14S)-10,13-dimethyl-2-[2-(2-pyrrolidin-1-ylethoxy)ethoxy]-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-6,17-dione |
|---|---|
| PubChem CID | 70346488 |
| Molecular Formula | C27H43NO4 |
| Molecular Weight | 445.64 g/mol |
| Exact Mass | 445.32 |
| IUPAC Name | (5S,8R,9S,10R,13S,14S)-10,13-dimethyl-2-[2-(2-pyrrolidin-1-ylethoxy)ethoxy]-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-6,17-dione |
| SMILES | C[C@]12CC(OCCOCCN3CCCC3)CC[C@@H]1C(=O)C[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C27H43NO4/c1-26-10-9-22-20(21(26)7-8-25(26)30)17-24(29)23-6-5-19(18-27(22,23)2)32-16-15-31-14-13-28-11-3-4-12-28/h19-23H,3-18H2,1-2H3/t19?,20-,21-,22-,23+,26-,27+/m0/s1 |
| InChIKey | CVGKRNAHIGKZCY-CCTWHYMMSA-N |
| XLogP | 4.27 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.64 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|