C29H46O6 — CID 70076439
(3S,5R,8R,9S,10S,13S,14S,17S)-17-(furan-3-yl)-3,17-bis(3-hydroxypropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-14-ol (PubChem CID 70076439) has the molecular formula C29H46O6 and a molecular weight of 490.68 g/mol. Its IUPAC name is (3S,5R,8R,9S,10S,13S,14S,17S)-17-(furan-3-yl)-3,17-bis(3-hydroxypropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-14-ol.
| Compound Name | (3S,5R,8R,9S,10S,13S,14S,17S)-17-(furan-3-yl)-3,17-bis(3-hydroxypropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-14-ol |
|---|---|
| PubChem CID | 70076439 |
| Molecular Formula | C29H46O6 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | (3S,5R,8R,9S,10S,13S,14S,17S)-17-(furan-3-yl)-3,17-bis(3-hydroxypropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-14-ol |
| SMILES | C[C@]12CC[C@H](OCCCO)C[C@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@](OCCCO)(c3ccoc3)CC[C@]12O |
| InChI | InChI=1S/C29H46O6/c1-26-10-7-23(34-16-3-14-30)19-21(26)5-6-25-24(26)8-11-27(2)28(25,32)12-13-29(27,35-17-4-15-31)22-9-18-33-20-22/h9,18,20-21,23-25,30-32H,3-8,10-17,19H2,1-2H3/t21-,23+,24+,25-,26+,27+,28+,29+/m1/s1 |
| InChIKey | MUVCRFYUSANDRU-RFVSSXCFSA-N |
| XLogP | 4.80 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|