C26H41N3O4 — CID 25130668
2-[2-[[(3S,5R,8R,9S,10S,13S,14S,17S)-17-(furan-3-yl)-14,17-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethyl]guanidine (PubChem CID 25130668) has the molecular formula C26H41N3O4 and a molecular weight of 459.63 g/mol. Its IUPAC name is 2-[2-[[(3S,5R,8R,9S,10S,13S,14S,17S)-17-(furan-3-yl)-14,17-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethyl]guanidine.
| Compound Name | 2-[2-[[(3S,5R,8R,9S,10S,13S,14S,17S)-17-(furan-3-yl)-14,17-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethyl]guanidine |
|---|---|
| PubChem CID | 25130668 |
| Molecular Formula | C26H41N3O4 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.31 |
| IUPAC Name | 2-[2-[[(3S,5R,8R,9S,10S,13S,14S,17S)-17-(furan-3-yl)-14,17-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethyl]guanidine |
| SMILES | C[C@]12CC[C@H](OCCN=C(N)N)C[C@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@](O)(c3ccoc3)CC[C@]12O |
| InChI | InChI=1S/C26H41N3O4/c1-23-8-5-19(33-14-12-29-22(27)28)15-17(23)3-4-21-20(23)6-9-24(2)25(30,10-11-26(21,24)31)18-7-13-32-16-18/h7,13,16-17,19-21,30-31H,3-6,8-12,14-15H2,1-2H3,(H4,27,28,29)/t17-,19+,20+,21-,23+,24-,25+,26+/m1/s1 |
| InChIKey | YCABFVPAYNCFAQ-KDXKWHTMSA-N |
| XLogP | 3.28 |
| TPSA | 127.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|