C26H42N2O4 — CID 67720878
(3S,5R,8R,9S,10S,13S,14S,17R)-3-(2,3-diaminopropoxy)-17-(furan-3-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-14,17-diol (PubChem CID 67720878) has the molecular formula C26H42N2O4 and a molecular weight of 446.63 g/mol. Its IUPAC name is (3S,5R,8R,9S,10S,13S,14S,17R)-3-(2,3-diaminopropoxy)-17-(furan-3-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-14,17-diol.
| Compound Name | (3S,5R,8R,9S,10S,13S,14S,17R)-3-(2,3-diaminopropoxy)-17-(furan-3-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-14,17-diol |
|---|---|
| PubChem CID | 67720878 |
| Molecular Formula | C26H42N2O4 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.31 |
| IUPAC Name | (3S,5R,8R,9S,10S,13S,14S,17R)-3-(2,3-diaminopropoxy)-17-(furan-3-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-14,17-diol |
| SMILES | C[C@]12CC[C@H](OCC(N)CN)C[C@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@](O)(c3ccoc3)CC[C@]12O |
| InChI | InChI=1S/C26H42N2O4/c1-23-8-5-20(32-16-19(28)14-27)13-17(23)3-4-22-21(23)6-9-24(2)25(29,10-11-26(22,24)30)18-7-12-31-15-18/h7,12,15,17,19-22,29-30H,3-6,8-11,13-14,16,27-28H2,1-2H3/t17-,19?,20+,21+,22-,23+,24-,25-,26+/m1/s1 |
| InChIKey | WEYBCKSZUGKTON-LFPMGPMQSA-N |
| XLogP | 3.30 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |