C26H38O3 — CID 67680331
(3S,5R,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-17-(4-methylphenyl)-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,14,17-triol (PubChem CID 67680331) has the molecular formula C26H38O3 and a molecular weight of 398.59 g/mol. Its IUPAC name is (3S,5R,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-17-(4-methylphenyl)-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,14,17-triol.
| Compound Name | (3S,5R,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-17-(4-methylphenyl)-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,14,17-triol |
|---|---|
| PubChem CID | 67680331 |
| Molecular Formula | C26H38O3 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | (3S,5R,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-17-(4-methylphenyl)-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,14,17-triol |
| SMILES | Cc1ccc([C@@]2(O)CC[C@]3(O)[C@@H]4CC[C@@H]5C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@]23C)cc1 |
| InChI | InChI=1S/C26H38O3/c1-17-4-6-18(7-5-17)25(28)14-15-26(29)22-9-8-19-16-20(27)10-12-23(19,2)21(22)11-13-24(25,26)3/h4-7,19-22,27-29H,8-16H2,1-3H3/t19-,20+,21+,22-,23+,24-,25+,26+/m1/s1 |
| InChIKey | BCRVKLNOIGFUKN-YWYMWPKSSA-N |
| XLogP | 4.70 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |