C29H46O6 — CID 70072966
(8R,9R,10S,13S,14R)-3-(2,2-diethoxyethoxy)-17-(furan-3-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-14,17-diol (PubChem CID 70072966) has the molecular formula C29H46O6 and a molecular weight of 490.68 g/mol. Its IUPAC name is (8R,9R,10S,13S,14R)-3-(2,2-diethoxyethoxy)-17-(furan-3-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-14,17-diol.
| Compound Name | (8R,9R,10S,13S,14R)-3-(2,2-diethoxyethoxy)-17-(furan-3-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-14,17-diol |
|---|---|
| PubChem CID | 70072966 |
| Molecular Formula | C29H46O6 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | (8R,9R,10S,13S,14R)-3-(2,2-diethoxyethoxy)-17-(furan-3-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-14,17-diol |
| SMILES | CCOC(COC1CC[C@@]2(C)C(CC[C@@H]3[C@H]2CC[C@]2(C)C(O)(c4ccoc4)CC[C@@]32O)C1)OCC |
| InChI | InChI=1S/C29H46O6/c1-5-33-25(34-6-2)19-35-22-9-12-26(3)20(17-22)7-8-24-23(26)10-13-27(4)28(30,14-15-29(24,27)31)21-11-16-32-18-21/h11,16,18,20,22-25,30-31H,5-10,12-15,17,19H2,1-4H3/t20?,22?,23-,24-,26+,27-,28?,29-/m1/s1 |
| InChIKey | JCAGFAIZIUZCPN-BOVLOJQCSA-N |
| XLogP | 5.41 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|