C35H54N2O3S — CID 67639903
(8R,9R,10R,13S,14R)-10,13-dimethyl-3,17-bis(2-pyrrolidin-1-ylethoxy)-17-thiophen-3-yl-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-14-ol (PubChem CID 67639903) has the molecular formula C35H54N2O3S and a molecular weight of 582.90 g/mol. Its IUPAC name is (8R,9R,10R,13S,14R)-10,13-dimethyl-3,17-bis(2-pyrrolidin-1-ylethoxy)-17-thiophen-3-yl-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-14-ol.
| Compound Name | (8R,9R,10R,13S,14R)-10,13-dimethyl-3,17-bis(2-pyrrolidin-1-ylethoxy)-17-thiophen-3-yl-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-14-ol |
|---|---|
| PubChem CID | 67639903 |
| Molecular Formula | C35H54N2O3S |
| Molecular Weight | 582.90 g/mol |
| Exact Mass | 582.39 |
| IUPAC Name | (8R,9R,10R,13S,14R)-10,13-dimethyl-3,17-bis(2-pyrrolidin-1-ylethoxy)-17-thiophen-3-yl-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-14-ol |
| SMILES | C[C@]12CCC(OCCN3CCCC3)CC1=CC[C@@H]1[C@H]2CC[C@]2(C)C(OCCN3CCCC3)(c3ccsc3)CC[C@@]12O |
| InChI | InChI=1S/C35H54N2O3S/c1-32-12-9-29(39-22-20-36-16-3-4-17-36)25-27(32)7-8-31-30(32)10-13-33(2)34(31,38)14-15-35(33,28-11-24-41-26-28)40-23-21-37-18-5-6-19-37/h7,11,24,26,29-31,38H,3-6,8-10,12-23,25H2,1-2H3/t29?,30-,31-,32+,33+,34-,35?/m1/s1 |
| InChIKey | ZYSGMUGWBHIXLC-XLCQNACZSA-N |
| XLogP | 6.61 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.90 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|