C32H47NO4 — CID 67640265
(8R,9R,10R,13S,14R)-17-(4-methoxyphenyl)-10,13-dimethyl-3-(2-pyrrolidin-1-ylethoxy)-2,3,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-14,17-diol (PubChem CID 67640265) has the molecular formula C32H47NO4 and a molecular weight of 509.73 g/mol. Its IUPAC name is (8R,9R,10R,13S,14R)-17-(4-methoxyphenyl)-10,13-dimethyl-3-(2-pyrrolidin-1-ylethoxy)-2,3,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-14,17-diol.
| Compound Name | (8R,9R,10R,13S,14R)-17-(4-methoxyphenyl)-10,13-dimethyl-3-(2-pyrrolidin-1-ylethoxy)-2,3,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-14,17-diol |
|---|---|
| PubChem CID | 67640265 |
| Molecular Formula | C32H47NO4 |
| Molecular Weight | 509.73 g/mol |
| Exact Mass | 509.35 |
| IUPAC Name | (8R,9R,10R,13S,14R)-17-(4-methoxyphenyl)-10,13-dimethyl-3-(2-pyrrolidin-1-ylethoxy)-2,3,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-14,17-diol |
| SMILES | COc1ccc(C2(O)CC[C@@]3(O)[C@@H]4CCC5=CC(OCCN6CCCC6)CC[C@]5(C)[C@@H]4CC[C@]23C)cc1 |
| InChI | InChI=1S/C32H47NO4/c1-29-14-12-26(37-21-20-33-18-4-5-19-33)22-24(29)8-11-28-27(29)13-15-30(2)31(34,16-17-32(28,30)35)23-6-9-25(36-3)10-7-23/h6-7,9-10,22,26-28,34-35H,4-5,8,11-21H2,1-3H3/t26?,27-,28-,29+,30-,31?,32-/m1/s1 |
| InChIKey | SKZAGIBNAGIAPY-DGHFGGHWSA-N |
| XLogP | 5.44 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.73 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|