C28H41NO3 — CID 67640041
(8R,9R,10R,13S,14R)-3-(3-aminopropoxy)-10,13-dimethyl-17-phenyl-2,3,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-14,17-diol (PubChem CID 67640041) has the molecular formula C28H41NO3 and a molecular weight of 439.64 g/mol. Its IUPAC name is (8R,9R,10R,13S,14R)-3-(3-aminopropoxy)-10,13-dimethyl-17-phenyl-2,3,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-14,17-diol.
| Compound Name | (8R,9R,10R,13S,14R)-3-(3-aminopropoxy)-10,13-dimethyl-17-phenyl-2,3,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-14,17-diol |
|---|---|
| PubChem CID | 67640041 |
| Molecular Formula | C28H41NO3 |
| Molecular Weight | 439.64 g/mol |
| Exact Mass | 439.31 |
| IUPAC Name | (8R,9R,10R,13S,14R)-3-(3-aminopropoxy)-10,13-dimethyl-17-phenyl-2,3,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-14,17-diol |
| SMILES | C[C@]12CCC(OCCCN)C=C1CC[C@@H]1[C@H]2CC[C@]2(C)C(O)(c3ccccc3)CC[C@@]12O |
| InChI | InChI=1S/C28H41NO3/c1-25-13-11-22(32-18-6-17-29)19-21(25)9-10-24-23(25)12-14-26(2)27(30,15-16-28(24,26)31)20-7-4-3-5-8-20/h3-5,7-8,19,22-24,30-31H,6,9-18,29H2,1-2H3/t22?,23-,24-,25+,26-,27?,28-/m1/s1 |
| InChIKey | KDFJRXBBAYVCNK-MSYKFQLMSA-N |
| XLogP | 4.69 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.64 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|