C26H34O5 — CID 57032728
4-[(8R,9R,10R,13S,14R)-3,14,17-trihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzoic acid (PubChem CID 57032728) has the molecular formula C26H34O5 and a molecular weight of 426.55 g/mol. Its IUPAC name is 4-[(8R,9R,10R,13S,14R)-3,14,17-trihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzoic acid.
| Compound Name | 4-[(8R,9R,10R,13S,14R)-3,14,17-trihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzoic acid |
|---|---|
| PubChem CID | 57032728 |
| Molecular Formula | C26H34O5 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 4-[(8R,9R,10R,13S,14R)-3,14,17-trihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzoic acid |
| SMILES | C[C@]12CCC(O)CC1=CC[C@@H]1[C@H]2CC[C@]2(C)C(O)(c3ccc(C(=O)O)cc3)CC[C@@]12O |
| InChI | InChI=1S/C26H34O5/c1-23-11-9-19(27)15-18(23)7-8-21-20(23)10-12-24(2)25(30,13-14-26(21,24)31)17-5-3-16(4-6-17)22(28)29/h3-7,19-21,27,30-31H,8-15H2,1-2H3,(H,28,29)/t19?,20-,21-,23+,24-,25?,26-/m1/s1 |
| InChIKey | BXFFBTMCDXVPJY-DTFDEVDLSA-N |
| XLogP | 4.01 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|