C25H32O3 — CID 57202293
(3S,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-17-phenyl-2,3,8,9,11,12,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,14,17-triol (PubChem CID 57202293) has the molecular formula C25H32O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-17-phenyl-2,3,8,9,11,12,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,14,17-triol.
| Compound Name | (3S,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-17-phenyl-2,3,8,9,11,12,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,14,17-triol |
|---|---|
| PubChem CID | 57202293 |
| Molecular Formula | C25H32O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-17-phenyl-2,3,8,9,11,12,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,14,17-triol |
| SMILES | C[C@]12CC[C@H]3[C@@H](C=CC4=C[C@@H](O)CC[C@@]43C)[C@@]1(O)CC[C@]2(O)c1ccccc1 |
| InChI | InChI=1S/C25H32O3/c1-22-12-10-19(26)16-18(22)8-9-21-20(22)11-13-23(2)24(27,14-15-25(21,23)28)17-6-4-3-5-7-17/h3-9,16,19-21,26-28H,10-15H2,1-2H3/t19-,20-,21+,22-,23+,24-,25-/m0/s1 |
| InChIKey | RGHGCDYJGCKXRZ-GRRKTJPFSA-N |
| XLogP | 4.09 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |