C24H37NO4 — CID 143404688
(3S,5S,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-17-(1-methylpyrrol-3-yl)-1,2,3,4,6,7,8,9,11,12,15,16-dodecahydrocyclopenta[a]phenanthrene-3,5,14,17-tetrol (PubChem CID 143404688) has the molecular formula C24H37NO4 and a molecular weight of 403.56 g/mol. Its IUPAC name is (3S,5S,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-17-(1-methylpyrrol-3-yl)-1,2,3,4,6,7,8,9,11,12,15,16-dodecahydrocyclopenta[a]phenanthrene-3,5,14,17-tetrol.
| Compound Name | (3S,5S,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-17-(1-methylpyrrol-3-yl)-1,2,3,4,6,7,8,9,11,12,15,16-dodecahydrocyclopenta[a]phenanthrene-3,5,14,17-tetrol |
|---|---|
| PubChem CID | 143404688 |
| Molecular Formula | C24H37NO4 |
| Molecular Weight | 403.56 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | (3S,5S,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-17-(1-methylpyrrol-3-yl)-1,2,3,4,6,7,8,9,11,12,15,16-dodecahydrocyclopenta[a]phenanthrene-3,5,14,17-tetrol |
| SMILES | Cn1ccc([C@]2(O)CC[C@]3(O)[C@@H]4CC[C@]5(O)C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@]23C)c1 |
| InChI | InChI=1S/C24H37NO4/c1-20-8-4-17(26)14-22(20,27)10-6-19-18(20)5-9-21(2)23(28,11-12-24(19,21)29)16-7-13-25(3)15-16/h7,13,15,17-19,26-29H,4-6,8-12,14H2,1-3H3/t17-,18-,19+,20+,21+,22-,23+,24-/m0/s1 |
| InChIKey | HCWSRMRPTJQZLG-RARTXIQTSA-N |
| XLogP | 2.85 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.56 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |