C24H33NO3 — CID 57159766
(8R,9R,10R,13S,14R)-10,13-dimethyl-17-pyridin-3-yl-2,3,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,14,17-triol (PubChem CID 57159766) has the molecular formula C24H33NO3 and a molecular weight of 383.53 g/mol. Its IUPAC name is (8R,9R,10R,13S,14R)-10,13-dimethyl-17-pyridin-3-yl-2,3,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,14,17-triol.
| Compound Name | (8R,9R,10R,13S,14R)-10,13-dimethyl-17-pyridin-3-yl-2,3,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,14,17-triol |
|---|---|
| PubChem CID | 57159766 |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | (8R,9R,10R,13S,14R)-10,13-dimethyl-17-pyridin-3-yl-2,3,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,14,17-triol |
| SMILES | C[C@]12CCC(O)C=C1CC[C@@H]1[C@H]2CC[C@]2(C)C(O)(c3cccnc3)CC[C@@]12O |
| InChI | InChI=1S/C24H33NO3/c1-21-9-7-18(26)14-16(21)5-6-20-19(21)8-10-22(2)23(27,11-12-24(20,22)28)17-4-3-13-25-15-17/h3-4,13-15,18-20,26-28H,5-12H2,1-2H3/t18?,19-,20-,21+,22-,23?,24-/m1/s1 |
| InChIKey | VGXSVKCWQMADRH-BTNZFBCUSA-N |
| XLogP | 3.71 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|