C23H32N2O3 — CID 46945548
(5R,10S,13S,14S,17S)-14,17-dihydroxy-10,13-dimethyl-17-pyridazin-4-yl-1,2,4,5,6,7,8,9,11,12,15,16-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 46945548) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is (5R,10S,13S,14S,17S)-14,17-dihydroxy-10,13-dimethyl-17-pyridazin-4-yl-1,2,4,5,6,7,8,9,11,12,15,16-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (5R,10S,13S,14S,17S)-14,17-dihydroxy-10,13-dimethyl-17-pyridazin-4-yl-1,2,4,5,6,7,8,9,11,12,15,16-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 46945548 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | (5R,10S,13S,14S,17S)-14,17-dihydroxy-10,13-dimethyl-17-pyridazin-4-yl-1,2,4,5,6,7,8,9,11,12,15,16-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC3C(CC[C@@H]4CC(=O)CC[C@]34C)[C@@]1(O)CC[C@]2(O)c1ccnnc1 |
| InChI | InChI=1S/C23H32N2O3/c1-20-8-5-17(26)13-15(20)3-4-19-18(20)6-9-21(2)22(27,10-11-23(19,21)28)16-7-12-24-25-14-16/h7,12,14-15,18-19,27-28H,3-6,8-11,13H2,1-2H3/t15-,18?,19?,20+,21-,22+,23+/m1/s1 |
| InChIKey | VBIUEHYKSUYLKL-RSZGZPIUSA-N |
| XLogP | 3.39 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |