C22H31NO3S — CID 67640394
(3S,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-17-(1,3-thiazol-2-yl)-2,3,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,14,17-triol (PubChem CID 67640394) has the molecular formula C22H31NO3S and a molecular weight of 389.56 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-17-(1,3-thiazol-2-yl)-2,3,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,14,17-triol.
| Compound Name | (3S,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-17-(1,3-thiazol-2-yl)-2,3,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,14,17-triol |
|---|---|
| PubChem CID | 67640394 |
| Molecular Formula | C22H31NO3S |
| Molecular Weight | 389.56 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-17-(1,3-thiazol-2-yl)-2,3,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,14,17-triol |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=C[C@@H](O)CC[C@@]43C)[C@@]1(O)CC[C@]2(O)c1nccs1 |
| InChI | InChI=1S/C22H31NO3S/c1-19-7-5-15(24)13-14(19)3-4-17-16(19)6-8-20(2)21(17,25)9-10-22(20,26)18-23-11-12-27-18/h11-13,15-17,24-26H,3-10H2,1-2H3/t15-,16-,17+,19-,20-,21-,22-/m0/s1 |
| InChIKey | MVSHZPCGSYGJTR-QCQQLPRJSA-N |
| XLogP | 3.77 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|