C24H33NO2 — CID 67584101
(3S,8R,9S,10R,13R,14S,17R)-10,13-dimethyl-17-pyridin-3-yl-1,2,3,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,14-diol (PubChem CID 67584101) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol. Its IUPAC name is (3S,8R,9S,10R,13R,14S,17R)-10,13-dimethyl-17-pyridin-3-yl-1,2,3,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,14-diol.
| Compound Name | (3S,8R,9S,10R,13R,14S,17R)-10,13-dimethyl-17-pyridin-3-yl-1,2,3,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,14-diol |
|---|---|
| PubChem CID | 67584101 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | (3S,8R,9S,10R,13R,14S,17R)-10,13-dimethyl-17-pyridin-3-yl-1,2,3,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,14-diol |
| SMILES | C[C@]12CC[C@H](O)C=C1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](c3cccnc3)CC[C@]12O |
| InChI | InChI=1S/C24H33NO2/c1-22-10-7-18(26)14-17(22)5-6-21-20(22)8-11-23(2)19(9-12-24(21,23)27)16-4-3-13-25-15-16/h3-4,13-15,18-21,26-27H,5-12H2,1-2H3/t18-,19+,20-,21+,22-,23+,24-/m0/s1 |
| InChIKey | IJYGEFKYEWCXTG-IHROFAPWSA-N |
| XLogP | 4.60 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|