C29H39NO6 — CID 155269178
[(8R,9S,10R,13R,14S,17R)-14-hydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-1,2,3,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 3-hydroxypyrrolidine-1-carboxylate (PubChem CID 155269178) has the molecular formula C29H39NO6 and a molecular weight of 497.63 g/mol. Its IUPAC name is [(8R,9S,10R,13R,14S,17R)-14-hydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-1,2,3,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 3-hydroxypyrrolidine-1-carboxylate.
| Compound Name | [(8R,9S,10R,13R,14S,17R)-14-hydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-1,2,3,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 3-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 155269178 |
| Molecular Formula | C29H39NO6 |
| Molecular Weight | 497.63 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | [(8R,9S,10R,13R,14S,17R)-14-hydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-1,2,3,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 3-hydroxypyrrolidine-1-carboxylate |
| SMILES | C[C@]12CCC(OC(=O)N3CCC(O)C3)C=C1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](c3ccc(=O)oc3)CC[C@]12O |
| InChI | InChI=1S/C29H39NO6/c1-27-11-7-21(36-26(33)30-14-10-20(31)16-30)15-19(27)4-5-24-23(27)8-12-28(2)22(9-13-29(24,28)34)18-3-6-25(32)35-17-18/h3,6,15,17,20-24,31,34H,4-5,7-14,16H2,1-2H3/t20?,21?,22-,23+,24-,27+,28-,29+/m1/s1 |
| InChIKey | HLSAMGAXPSNGDJ-JWHULQIUSA-N |
| XLogP | 4.37 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.63 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|