C27H39NO4 — CID 143729142
ethane;5-[(3E,8R)-14-hydroxy-3-methoxyimino-10,13-dimethyl-2,6,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one (PubChem CID 143729142) has the molecular formula C27H39NO4 and a molecular weight of 441.61 g/mol. Its IUPAC name is ethane;5-[(3E,8R)-14-hydroxy-3-methoxyimino-10,13-dimethyl-2,6,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one.
| Compound Name | ethane;5-[(3E,8R)-14-hydroxy-3-methoxyimino-10,13-dimethyl-2,6,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one |
|---|---|
| PubChem CID | 143729142 |
| Molecular Formula | C27H39NO4 |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.29 |
| IUPAC Name | ethane;5-[(3E,8R)-14-hydroxy-3-methoxyimino-10,13-dimethyl-2,6,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one |
| SMILES | CC.CO/N=C1/C=C2CC[C@@H]3C(CCC4(C)C(c5ccc(=O)oc5)CCC34O)C2(C)CC1 |
| InChI | InChI=1S/C25H33NO4.C2H6/c1-23-11-8-18(26-29-3)14-17(23)5-6-21-20(23)9-12-24(2)19(10-13-25(21,24)28)16-4-7-22(27)30-15-16;1-2/h4,7,14-15,19-21,28H,5-6,8-13H2,1-3H3;1-2H3/b26-18+;/t19?,20?,21-,23?,24?,25?;/m1./s1 |
| InChIKey | MAKPVSBEXAWZRO-JMNJVOJASA-N |
| XLogP | 5.83 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|