C34H50N2O4 — CID 143729159
5-[(3E)-14-hydroxy-10,13-dimethyl-3-(5-piperidin-1-ylpentoxyimino)-2,6,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one (PubChem CID 143729159) has the molecular formula C34H50N2O4 and a molecular weight of 550.78 g/mol. Its IUPAC name is 5-[(3E)-14-hydroxy-10,13-dimethyl-3-(5-piperidin-1-ylpentoxyimino)-2,6,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one.
| Compound Name | 5-[(3E)-14-hydroxy-10,13-dimethyl-3-(5-piperidin-1-ylpentoxyimino)-2,6,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one |
|---|---|
| PubChem CID | 143729159 |
| Molecular Formula | C34H50N2O4 |
| Molecular Weight | 550.78 g/mol |
| Exact Mass | 550.38 |
| IUPAC Name | 5-[(3E)-14-hydroxy-10,13-dimethyl-3-(5-piperidin-1-ylpentoxyimino)-2,6,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one |
| SMILES | CC12CC/C(=N\OCCCCCN3CCCCC3)C=C1CCC1C2CCC2(C)C(c3ccc(=O)oc3)CCC12O |
| InChI | InChI=1S/C34H50N2O4/c1-32-16-13-27(35-40-22-8-4-7-21-36-19-5-3-6-20-36)23-26(32)10-11-30-29(32)14-17-33(2)28(15-18-34(30,33)38)25-9-12-31(37)39-24-25/h9,12,23-24,28-30,38H,3-8,10-11,13-22H2,1-2H3/b35-27+ |
| InChIKey | KFPHNRPLAWILBX-ROMHNNFLSA-N |
| XLogP | 6.83 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.78 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|