C25H32O5 — CID 138469292
[14-hydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-1,2,3,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] formate (PubChem CID 138469292) has the molecular formula C25H32O5 and a molecular weight of 412.53 g/mol. Its IUPAC name is [14-hydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-1,2,3,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] formate.
| Compound Name | [14-hydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-1,2,3,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] formate |
|---|---|
| PubChem CID | 138469292 |
| Molecular Formula | C25H32O5 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | [14-hydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-1,2,3,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] formate |
| SMILES | CC12CCC(OC=O)C=C1CCC1C2CCC2(C)C(c3ccc(=O)oc3)CCC12O |
| InChI | InChI=1S/C25H32O5/c1-23-10-7-18(30-15-26)13-17(23)4-5-21-20(23)8-11-24(2)19(9-12-25(21,24)28)16-3-6-22(27)29-14-16/h3,6,13-15,18-21,28H,4-5,7-12H2,1-2H3 |
| InChIKey | ZYQAZAKJFWHFSP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|