C30H43N3O4 — CID 89030868
5-[(3E,8R,9S,10R,13R,14S,17R)-14-hydroxy-10,13-dimethyl-3-(1-piperazin-1-ylethoxyimino)-2,6,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one (PubChem CID 89030868) has the molecular formula C30H43N3O4 and a molecular weight of 509.69 g/mol. Its IUPAC name is 5-[(3E,8R,9S,10R,13R,14S,17R)-14-hydroxy-10,13-dimethyl-3-(1-piperazin-1-ylethoxyimino)-2,6,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one.
| Compound Name | 5-[(3E,8R,9S,10R,13R,14S,17R)-14-hydroxy-10,13-dimethyl-3-(1-piperazin-1-ylethoxyimino)-2,6,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one |
|---|---|
| PubChem CID | 89030868 |
| Molecular Formula | C30H43N3O4 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.33 |
| IUPAC Name | 5-[(3E,8R,9S,10R,13R,14S,17R)-14-hydroxy-10,13-dimethyl-3-(1-piperazin-1-ylethoxyimino)-2,6,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one |
| SMILES | CC(O/N=C1/C=C2CC[C@@H]3[C@H](CC[C@]4(C)[C@@H](c5ccc(=O)oc5)CC[C@]34O)[C@@]2(C)CC1)N1CCNCC1 |
| InChI | InChI=1S/C30H43N3O4/c1-20(33-16-14-31-15-17-33)37-32-23-8-11-28(2)22(18-23)5-6-26-25(28)9-12-29(3)24(10-13-30(26,29)35)21-4-7-27(34)36-19-21/h4,7,18-20,24-26,31,35H,5-6,8-17H2,1-3H3/b32-23+/t20?,24-,25+,26-,28+,29-,30+/m1/s1 |
| InChIKey | UUIVDADPXVFVNH-XEPNNHIDSA-N |
| XLogP | 4.42 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|