C28H38O3 — CID 22865413
(3S,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-17-phenyl-3-prop-2-enoxy-2,3,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-14,17-diol (PubChem CID 22865413) has the molecular formula C28H38O3 and a molecular weight of 422.61 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-17-phenyl-3-prop-2-enoxy-2,3,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-14,17-diol.
| Compound Name | (3S,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-17-phenyl-3-prop-2-enoxy-2,3,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-14,17-diol |
|---|---|
| PubChem CID | 22865413 |
| Molecular Formula | C28H38O3 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-17-phenyl-3-prop-2-enoxy-2,3,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-14,17-diol |
| SMILES | C=CCO[C@@H]1C=C2CC[C@@H]3[C@H](CC[C@]4(C)[C@@](O)(c5ccccc5)CC[C@]34O)[C@@]2(C)CC1 |
| InChI | InChI=1S/C28H38O3/c1-4-18-31-22-12-14-25(2)21(19-22)10-11-24-23(25)13-15-26(3)27(29,16-17-28(24,26)30)20-8-6-5-7-9-20/h4-9,19,22-24,29-30H,1,10-18H2,2-3H3/t22-,23-,24+,25-,26+,27-,28-/m0/s1 |
| InChIKey | SLKCQOAUEJKNAF-VNKLLESCSA-N |
| XLogP | 5.52 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|