C29H43NO4 — CID 22865401
(3S,8R,9S,10R,13S,14S,17R)-17-(furan-2-yl)-10,13-dimethyl-3-(2-pyrrolidin-1-ylethoxy)-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-14,17-diol (PubChem CID 22865401) has the molecular formula C29H43NO4 and a molecular weight of 469.67 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S,17R)-17-(furan-2-yl)-10,13-dimethyl-3-(2-pyrrolidin-1-ylethoxy)-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-14,17-diol.
| Compound Name | (3S,8R,9S,10R,13S,14S,17R)-17-(furan-2-yl)-10,13-dimethyl-3-(2-pyrrolidin-1-ylethoxy)-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-14,17-diol |
|---|---|
| PubChem CID | 22865401 |
| Molecular Formula | C29H43NO4 |
| Molecular Weight | 469.67 g/mol |
| Exact Mass | 469.32 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S,17R)-17-(furan-2-yl)-10,13-dimethyl-3-(2-pyrrolidin-1-ylethoxy)-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthrene-14,17-diol |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4C[C@@H](OCCN5CCCC5)CC[C@@]43C)[C@@]1(O)CC[C@]2(O)c1ccco1 |
| InChI | InChI=1S/C29H43NO4/c1-26-11-9-22(33-19-17-30-15-3-4-16-30)20-21(26)7-8-24-23(26)10-12-27(2)28(24,31)13-14-29(27,32)25-6-5-18-34-25/h5-7,18,22-24,31-32H,3-4,8-17,19-20H2,1-2H3/t22-,23-,24+,26-,27-,28-,29-/m0/s1 |
| InChIKey | NMFZRWDSZRXLKC-QHCKMTAXSA-N |
| XLogP | 5.03 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.67 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|